C22H21N3O3S — CID 157256100
1-[2-(cyclopropylsulfonylmethyl)pyrimidin-4-yl]-3-(4-pyridin-3-ylphenyl)propan-2-one (PubChem CID 157256100) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is 1-[2-(cyclopropylsulfonylmethyl)pyrimidin-4-yl]-3-(4-pyridin-3-ylphenyl)propan-2-one.
| Compound Name | 1-[2-(cyclopropylsulfonylmethyl)pyrimidin-4-yl]-3-(4-pyridin-3-ylphenyl)propan-2-one |
|---|---|
| PubChem CID | 157256100 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-[2-(cyclopropylsulfonylmethyl)pyrimidin-4-yl]-3-(4-pyridin-3-ylphenyl)propan-2-one |
| SMILES | O=C(Cc1ccc(-c2cccnc2)cc1)Cc1ccnc(CS(=O)(=O)C2CC2)n1 |
| InChI | InChI=1S/C22H21N3O3S/c26-20(12-16-3-5-17(6-4-16)18-2-1-10-23-14-18)13-19-9-11-24-22(25-19)15-29(27,28)21-7-8-21/h1-6,9-11,14,21H,7-8,12-13,15H2 |
| InChIKey | AWXHVGGUHXSQJW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 89.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |