C11H17ClN2O2S — CID 71645608
3-(piperidin-4-ylsulfonylmethyl)pyridine;hydrochloride (PubChem CID 71645608) has the molecular formula C11H17ClN2O2S and a molecular weight of 276.79 g/mol. Its IUPAC name is 3-(piperidin-4-ylsulfonylmethyl)pyridine;hydrochloride.
| Compound Name | 3-(piperidin-4-ylsulfonylmethyl)pyridine;hydrochloride |
|---|---|
| PubChem CID | 71645608 |
| Molecular Formula | C11H17ClN2O2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-(piperidin-4-ylsulfonylmethyl)pyridine;hydrochloride |
| SMILES | Cl.O=S(=O)(Cc1cccnc1)C1CCNCC1 |
| InChI | InChI=1S/C11H16N2O2S.ClH/c14-16(15,11-3-6-12-7-4-11)9-10-2-1-5-13-8-10;/h1-2,5,8,11-12H,3-4,6-7,9H2;1H |
| InChIKey | UYJFHMNJMOCREV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |