C11H15ClN2O2S — CID 71639933
2-chloro-5-(piperidin-4-ylsulfonylmethyl)pyridine (PubChem CID 71639933) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is 2-chloro-5-(piperidin-4-ylsulfonylmethyl)pyridine.
| Compound Name | 2-chloro-5-(piperidin-4-ylsulfonylmethyl)pyridine |
|---|---|
| PubChem CID | 71639933 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-chloro-5-(piperidin-4-ylsulfonylmethyl)pyridine |
| SMILES | O=S(=O)(Cc1ccc(Cl)nc1)C1CCNCC1 |
| InChI | InChI=1S/C11H15ClN2O2S/c12-11-2-1-9(7-14-11)8-17(15,16)10-3-5-13-6-4-10/h1-2,7,10,13H,3-6,8H2 |
| InChIKey | LFPUEQJEKHBNPJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|