C10H13ClN2OS — CID 97163603
2-chloro-5-[[(S)-[(3S)-pyrrolidin-3-yl]sulfinyl]methyl]pyridine (PubChem CID 97163603) has the molecular formula C10H13ClN2OS and a molecular weight of 244.75 g/mol. Its IUPAC name is 2-chloro-5-[[(S)-[(3S)-pyrrolidin-3-yl]sulfinyl]methyl]pyridine.
| Compound Name | 2-chloro-5-[[(S)-[(3S)-pyrrolidin-3-yl]sulfinyl]methyl]pyridine |
|---|---|
| PubChem CID | 97163603 |
| Molecular Formula | C10H13ClN2OS |
| Molecular Weight | 244.75 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-chloro-5-[[(S)-[(3S)-pyrrolidin-3-yl]sulfinyl]methyl]pyridine |
| SMILES | O=[S@@](Cc1ccc(Cl)nc1)[C@H]1CCNC1 |
| InChI | InChI=1S/C10H13ClN2OS/c11-10-2-1-8(5-13-10)7-15(14)9-3-4-12-6-9/h1-2,5,9,12H,3-4,6-7H2/t9-,15-/m0/s1 |
| InChIKey | YFAXUISGTPIHMD-VFZGTOFNSA-N |
| XLogP | 1.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.75 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|