C26H46N4O7 — CID 157257039
(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoate;(Z)-7-[(2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoate (PubChem CID 157257039) has the molecular formula C26H46N4O7 and a molecular weight of 526.68 g/mol. Its IUPAC name is (2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoate;(Z)-7-[(2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoate.
| Compound Name | (2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoate;(Z)-7-[(2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 157257039 |
| Molecular Formula | C26H46N4O7 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | (2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoate;(Z)-7-[(2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C(=O)C[C@H](O)C1C/C=C\CCCC(=O)[O-].NC(N)=[NH+]CCC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C20H32O5.C6H14N4O2/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25;7-4(5(11)12)2-1-3-10-6(8)9/h4,7,12-13,15-18,21-22H,2-3,5-6,8-11,14H2,1H3,(H,24,25);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/b7-4-,13-12+;/t15-,16?,17+,18-;4-/m00/s1 |
| InChIKey | AWZWCMGYLPGTOH-QZJYEGNQSA-N |
| XLogP | -3.60 |
| TPSA | 231.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|