C31H47NO8 — CID 157258003
[2-[3-[4-[[[2-(2-methylprop-2-enoyloxy)cyclohexyl]oxycarbonylamino]methyl]cyclohexyl]propanoyloxy]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 157258003) has the molecular formula C31H47NO8 and a molecular weight of 561.72 g/mol. Its IUPAC name is [2-[3-[4-[[[2-(2-methylprop-2-enoyloxy)cyclohexyl]oxycarbonylamino]methyl]cyclohexyl]propanoyloxy]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [2-[3-[4-[[[2-(2-methylprop-2-enoyloxy)cyclohexyl]oxycarbonylamino]methyl]cyclohexyl]propanoyloxy]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 157258003 |
| Molecular Formula | C31H47NO8 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | [2-[3-[4-[[[2-(2-methylprop-2-enoyloxy)cyclohexyl]oxycarbonylamino]methyl]cyclohexyl]propanoyloxy]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCCC1OC(=O)CCC1CCC(CNC(=O)OC2CCCCC2OC(=O)C(=C)C)CC1 |
| InChI | InChI=1S/C31H47NO8/c1-20(2)29(34)38-25-10-6-5-9-24(25)37-28(33)18-17-22-13-15-23(16-14-22)19-32-31(36)40-27-12-8-7-11-26(27)39-30(35)21(3)4/h22-27H,1,3,5-19H2,2,4H3,(H,32,36) |
| InChIKey | AXCRIVGEBWAOPX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|