C15H29NO3Si — CID 163721445
[5-[2-[dimethyl(methylamino)silyl]ethyl]-2-hydroxycyclohexyl] 2-methylprop-2-enoate (PubChem CID 163721445) has the molecular formula C15H29NO3Si and a molecular weight of 299.49 g/mol. Its IUPAC name is [5-[2-[dimethyl(methylamino)silyl]ethyl]-2-hydroxycyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [5-[2-[dimethyl(methylamino)silyl]ethyl]-2-hydroxycyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163721445 |
| Molecular Formula | C15H29NO3Si |
| Molecular Weight | 299.49 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | [5-[2-[dimethyl(methylamino)silyl]ethyl]-2-hydroxycyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC(CC[Si](C)(C)NC)CCC1O |
| InChI | InChI=1S/C15H29NO3Si/c1-11(2)15(18)19-14-10-12(6-7-13(14)17)8-9-20(4,5)16-3/h12-14,16-17H,1,6-10H2,2-5H3 |
| InChIKey | KRYSJALHNMHKTK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|