C12H18O5 — CID 67710166
(2-hydroxycyclobutyl) 2-methylprop-2-enoate;methyl prop-2-enoate (PubChem CID 67710166) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (2-hydroxycyclobutyl) 2-methylprop-2-enoate;methyl prop-2-enoate.
| Compound Name | (2-hydroxycyclobutyl) 2-methylprop-2-enoate;methyl prop-2-enoate |
|---|---|
| PubChem CID | 67710166 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (2-hydroxycyclobutyl) 2-methylprop-2-enoate;methyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC1O.C=CC(=O)OC |
| InChI | InChI=1S/C8H12O3.C4H6O2/c1-5(2)8(10)11-7-4-3-6(7)9;1-3-4(5)6-2/h6-7,9H,1,3-4H2,2H3;3H,1H2,2H3 |
| InChIKey | HHTDCSHIYXBVTR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|