C15H16F3IO3 — CID 157263816
carbon dioxide;2-[(E)-hept-4-enoxy]-1-iodo-4-(trifluoromethyl)benzene (PubChem CID 157263816) has the molecular formula C15H16F3IO3 and a molecular weight of 428.19 g/mol. Its IUPAC name is carbon dioxide;2-[(E)-hept-4-enoxy]-1-iodo-4-(trifluoromethyl)benzene.
| Compound Name | carbon dioxide;2-[(E)-hept-4-enoxy]-1-iodo-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 157263816 |
| Molecular Formula | C15H16F3IO3 |
| Molecular Weight | 428.19 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | carbon dioxide;2-[(E)-hept-4-enoxy]-1-iodo-4-(trifluoromethyl)benzene |
| SMILES | CC/C=C/CCCOc1cc(C(F)(F)F)ccc1I.O=C=O |
| InChI | InChI=1S/C14H16F3IO.CO2/c1-2-3-4-5-6-9-19-13-10-11(14(15,16)17)7-8-12(13)18;2-1-3/h3-4,7-8,10H,2,5-6,9H2,1H3;/b4-3+; |
| InChIKey | AXTPBDBHEBGTRY-BJILWQEISA-N |
| XLogP | 4.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.19 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|