C24H29NO2 — CID 157264817
2-(2,2,6,6-tetramethylpiperidin-4-yl)-1-(9H-xanthen-2-yl)ethanone (PubChem CID 157264817) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethylpiperidin-4-yl)-1-(9H-xanthen-2-yl)ethanone.
| Compound Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)-1-(9H-xanthen-2-yl)ethanone |
|---|---|
| PubChem CID | 157264817 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)-1-(9H-xanthen-2-yl)ethanone |
| SMILES | CC1(C)CC(CC(=O)c2ccc3c(c2)Cc2ccccc2O3)CC(C)(C)N1 |
| InChI | InChI=1S/C24H29NO2/c1-23(2)14-16(15-24(3,4)25-23)11-20(26)17-9-10-22-19(12-17)13-18-7-5-6-8-21(18)27-22/h5-10,12,16,25H,11,13-15H2,1-4H3 |
| InChIKey | AXWJWJXIGIGDQT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |