C38H35Cl3O5 — CID 163467489
1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene (PubChem CID 163467489) has the molecular formula C38H35Cl3O5 and a molecular weight of 678.05 g/mol. Its IUPAC name is 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene.
| Compound Name | 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene |
|---|---|
| PubChem CID | 163467489 |
| Molecular Formula | C38H35Cl3O5 |
| Molecular Weight | 678.05 g/mol |
| Exact Mass | 676.16 |
| IUPAC Name | 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene |
| SMILES | O=C(CCCCl)c1ccc2c(c1)Cc1c(ccc(C(=O)CCCCl)c1C(=O)CCCCl)O2.c1ccc2c(c1)Cc1ccccc1O2 |
| InChI | InChI=1S/C25H25Cl3O4.C13H10O/c26-11-1-4-20(29)16-7-9-23-17(14-16)15-19-24(32-23)10-8-18(21(30)5-2-12-27)25(19)22(31)6-3-13-28;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h7-10,14H,1-6,11-13,15H2;1-8H,9H2 |
| InChIKey | BTVCGBQCRFKLJW-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.05 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|