About 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene
1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene (PubChem CID 163467489) has the molecular formula C38H35Cl3O5
and a molecular weight of 678.05 g/mol. Its IUPAC name is 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene.
Molecular Properties
| Compound Name | 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene |
| PubChem CID | 163467489 |
| Molecular Formula | C38H35Cl3O5 |
| Molecular Weight | 678.05 g/mol |
| Exact Mass | 676.16 |
| IUPAC Name | 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene |
| SMILES | O=C(CCCCl)c1ccc2c(c1)Cc1c(ccc(C(=O)CCCCl)c1C(=O)CCCCl)O2.c1ccc2c(c1)Cc1ccccc1O2 |
| InChI | InChI=1S/C25H25Cl3O4.C13H10O/c26-11-1-4-20(29)16-7-9-23-17(14-16)15-19-24(32-23)10-8-18(21(30)5-2-12-27)25(19)22(31)6-3-13-28;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h7-10,14H,1-6,11-13,15H2;1-8H,9H2 |
| InChIKey | BTVCGBQCRFKLJW-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 678.05 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene?
The IUPAC name of 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene (CID 163467489) is 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene.
What is the SMILES notation for 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene?
The canonical SMILES for 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene is O=C(CCCCl)c1ccc2c(c1)Cc1c(ccc(C(=O)CCCCl)c1C(=O)CCCCl)O2.c1ccc2c(c1)Cc1ccccc1O2.
What is the InChIKey of 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene?
The InChIKey is BTVCGBQCRFKLJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25Cl3O4.C13H10O/c26-11-1-4-20(29)16-7-9-23-17(14-16)15-19-24(32-23)10-8-18(21(30)5-2-12-27)25(19)22(31)6-3-13-28;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h7-10,14H,1-6,11-13,15H2;1-8H,9H2.
What are the key properties of 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene?
1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene has a molecular weight of 678.05 g/mol, XLogP of 10.37, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[7,8-bis(4-chlorobutanoyl)-9H-xanthen-2-yl]-4-chlorobutan-1-one;9H-xanthene is sourced from PubChem (CID 163467489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).