C41H41Cl3O3 — CID 163529008
1-[2,7-bis(5-chloropentanoyl)-9H-fluoren-1-yl]-4-chloropentan-1-one;9H-fluorene (PubChem CID 163529008) has the molecular formula C41H41Cl3O3 and a molecular weight of 688.14 g/mol. Its IUPAC name is 1-[2,7-bis(5-chloropentanoyl)-9H-fluoren-1-yl]-4-chloropentan-1-one;9H-fluorene.
| Compound Name | 1-[2,7-bis(5-chloropentanoyl)-9H-fluoren-1-yl]-4-chloropentan-1-one;9H-fluorene |
|---|---|
| PubChem CID | 163529008 |
| Molecular Formula | C41H41Cl3O3 |
| Molecular Weight | 688.14 g/mol |
| Exact Mass | 686.21 |
| IUPAC Name | 1-[2,7-bis(5-chloropentanoyl)-9H-fluoren-1-yl]-4-chloropentan-1-one;9H-fluorene |
| SMILES | CC(Cl)CCC(=O)c1c(C(=O)CCCCCl)ccc2c1Cc1cc(C(=O)CCCCCl)ccc1-2.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C28H31Cl3O3.C13H10/c1-18(31)8-13-27(34)28-23(26(33)7-3-5-15-30)12-11-22-21-10-9-19(16-20(21)17-24(22)28)25(32)6-2-4-14-29;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h9-12,16,18H,2-8,13-15,17H2,1H3;1-8H,9H2 |
| InChIKey | DRHNOGQPHKRRBH-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.14 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|