C13H13BrFNO2S — CID 157269363
tert-butyl 2-(4-bromo-7-fluoro-1,3-benzothiazol-2-yl)acetate (PubChem CID 157269363) has the molecular formula C13H13BrFNO2S and a molecular weight of 346.22 g/mol. Its IUPAC name is tert-butyl 2-(4-bromo-7-fluoro-1,3-benzothiazol-2-yl)acetate.
| Compound Name | tert-butyl 2-(4-bromo-7-fluoro-1,3-benzothiazol-2-yl)acetate |
|---|---|
| PubChem CID | 157269363 |
| Molecular Formula | C13H13BrFNO2S |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | tert-butyl 2-(4-bromo-7-fluoro-1,3-benzothiazol-2-yl)acetate |
| SMILES | CC(C)(C)OC(=O)Cc1nc2c(Br)ccc(F)c2s1 |
| InChI | InChI=1S/C13H13BrFNO2S/c1-13(2,3)18-10(17)6-9-16-11-7(14)4-5-8(15)12(11)19-9/h4-5H,6H2,1-3H3 |
| InChIKey | AYIYUBDBCOSSGE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |