C11H15NO3S — CID 158284808
tert-butyl 2-(5-acetyl-1,3-thiazol-2-yl)acetate (PubChem CID 158284808) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is tert-butyl 2-(5-acetyl-1,3-thiazol-2-yl)acetate.
| Compound Name | tert-butyl 2-(5-acetyl-1,3-thiazol-2-yl)acetate |
|---|---|
| PubChem CID | 158284808 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | tert-butyl 2-(5-acetyl-1,3-thiazol-2-yl)acetate |
| SMILES | CC(=O)c1cnc(CC(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C11H15NO3S/c1-7(13)8-6-12-9(16-8)5-10(14)15-11(2,3)4/h6H,5H2,1-4H3 |
| InChIKey | GKQKUHSKUNOWKD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |