C22H35N3O7S2 — CID 159774779
tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl 2-(1,3-thiazol-2-yl)acetate;1,3-thiazol-2-amine (PubChem CID 159774779) has the molecular formula C22H35N3O7S2 and a molecular weight of 517.67 g/mol. Its IUPAC name is tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl 2-(1,3-thiazol-2-yl)acetate;1,3-thiazol-2-amine.
| Compound Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl 2-(1,3-thiazol-2-yl)acetate;1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 159774779 |
| Molecular Formula | C22H35N3O7S2 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl 2-(1,3-thiazol-2-yl)acetate;1,3-thiazol-2-amine |
| SMILES | CC(C)(C)OC(=O)Cc1nccs1.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Nc1nccs1 |
| InChI | InChI=1S/C10H18O5.C9H13NO2S.C3H4N2S/c1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;1-9(2,3)12-8(11)6-7-10-4-5-13-7;4-3-5-1-2-6-3/h1-6H3;4-5H,6H2,1-3H3;1-2H,(H2,4,5) |
| InChIKey | NGPBMTZJQSACMI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 139.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|