C7H6F3NO3S — CID 154703079
1,1,1-trifluoro-4-(1,3-thiazol-2-yl)butane-2,3-dione;hydrate (PubChem CID 154703079) has the molecular formula C7H6F3NO3S and a molecular weight of 241.19 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(1,3-thiazol-2-yl)butane-2,3-dione;hydrate.
| Compound Name | 1,1,1-trifluoro-4-(1,3-thiazol-2-yl)butane-2,3-dione;hydrate |
|---|---|
| PubChem CID | 154703079 |
| Molecular Formula | C7H6F3NO3S |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 1,1,1-trifluoro-4-(1,3-thiazol-2-yl)butane-2,3-dione;hydrate |
| SMILES | O.O=C(Cc1nccs1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H4F3NO2S.H2O/c8-7(9,10)6(13)4(12)3-5-11-1-2-14-5;/h1-2H,3H2;1H2 |
| InChIKey | HLKKRWRNROCGLK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|