C16H27N3O4S — CID 67422068
2-amino-6-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-(1,3-thiazol-2-ylmethyl)amino]hexanoic acid (PubChem CID 67422068) has the molecular formula C16H27N3O4S and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-amino-6-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-(1,3-thiazol-2-ylmethyl)amino]hexanoic acid.
| Compound Name | 2-amino-6-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-(1,3-thiazol-2-ylmethyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 67422068 |
| Molecular Formula | C16H27N3O4S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-amino-6-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-(1,3-thiazol-2-ylmethyl)amino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)CN(CCCCC(N)C(=O)O)Cc1nccs1 |
| InChI | InChI=1S/C16H27N3O4S/c1-16(2,3)23-14(20)11-19(10-13-18-7-9-24-13)8-5-4-6-12(17)15(21)22/h7,9,12H,4-6,8,10-11,17H2,1-3H3,(H,21,22) |
| InChIKey | NNFHLCFDHUXNML-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|