C29H32N2 — CID 157271882
5-(2-methylhexan-2-yl)-1-(2-methyl-4-phenylphenyl)-2-phenylimidazole (PubChem CID 157271882) has the molecular formula C29H32N2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 5-(2-methylhexan-2-yl)-1-(2-methyl-4-phenylphenyl)-2-phenylimidazole.
| Compound Name | 5-(2-methylhexan-2-yl)-1-(2-methyl-4-phenylphenyl)-2-phenylimidazole |
|---|---|
| PubChem CID | 157271882 |
| Molecular Formula | C29H32N2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 5-(2-methylhexan-2-yl)-1-(2-methyl-4-phenylphenyl)-2-phenylimidazole |
| SMILES | CCCCC(C)(C)c1cnc(-c2ccccc2)n1-c1ccc(-c2ccccc2)cc1C |
| InChI | InChI=1S/C29H32N2/c1-5-6-19-29(3,4)27-21-30-28(24-15-11-8-12-16-24)31(27)26-18-17-25(20-22(26)2)23-13-9-7-10-14-23/h7-18,20-21H,5-6,19H2,1-4H3 |
| InChIKey | IURRTSRQLFZHSH-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |