C21H27NO — CID 15727242
N-benzyl-2-phenylmethoxyheptan-1-imine (PubChem CID 15727242) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is N-benzyl-2-phenylmethoxyheptan-1-imine.
| Compound Name | N-benzyl-2-phenylmethoxyheptan-1-imine |
|---|---|
| PubChem CID | 15727242 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-benzyl-2-phenylmethoxyheptan-1-imine |
| SMILES | CCCCCC(/C=N/Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C21H27NO/c1-2-3-6-15-21(23-18-20-13-9-5-10-14-20)17-22-16-19-11-7-4-8-12-19/h4-5,7-14,17,21H,2-3,6,15-16,18H2,1H3/b22-17+ |
| InChIKey | PMGOKULFCCNHFP-OQKWZONESA-N |
| XLogP | 5.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|