C17H18O2 — CID 157272956
[5-[(3,4-dimethylphenyl)methyl]-2-methylphenyl] formate (PubChem CID 157272956) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is [5-[(3,4-dimethylphenyl)methyl]-2-methylphenyl] formate.
| Compound Name | [5-[(3,4-dimethylphenyl)methyl]-2-methylphenyl] formate |
|---|---|
| PubChem CID | 157272956 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | [5-[(3,4-dimethylphenyl)methyl]-2-methylphenyl] formate |
| SMILES | Cc1ccc(Cc2ccc(C)c(OC=O)c2)cc1C |
| InChI | InChI=1S/C17H18O2/c1-12-4-6-15(8-14(12)3)9-16-7-5-13(2)17(10-16)19-11-18/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | HFPPCMUQPMJRAF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|