C34H40BBrN2O6 — CID 157272981
2-bromo-3-methylpyridine;tert-butyl 3-(3-methyl-2-pyridinyl)benzoate;[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid (PubChem CID 157272981) has the molecular formula C34H40BBrN2O6 and a molecular weight of 663.42 g/mol. Its IUPAC name is 2-bromo-3-methylpyridine;tert-butyl 3-(3-methyl-2-pyridinyl)benzoate;[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid.
| Compound Name | 2-bromo-3-methylpyridine;tert-butyl 3-(3-methyl-2-pyridinyl)benzoate;[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 157272981 |
| Molecular Formula | C34H40BBrN2O6 |
| Molecular Weight | 663.42 g/mol |
| Exact Mass | 662.22 |
| IUPAC Name | 2-bromo-3-methylpyridine;tert-butyl 3-(3-methyl-2-pyridinyl)benzoate;[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)c1cccc(B(O)O)c1.Cc1cccnc1-c1cccc(C(=O)OC(C)(C)C)c1.Cc1cccnc1Br |
| InChI | InChI=1S/C17H19NO2.C11H15BO4.C6H6BrN/c1-12-7-6-10-18-15(12)13-8-5-9-14(11-13)16(19)20-17(2,3)4;1-11(2,3)16-10(13)8-5-4-6-9(7-8)12(14)15;1-5-3-2-4-8-6(5)7/h5-11H,1-4H3;4-7,14-15H,1-3H3;2-4H,1H3 |
| InChIKey | AYTGTKNRIPATBL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.42 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|