C20H20O4 — CID 157276109
(6S,8R,9R)-9-(1,3-benzodioxol-5-yl)-6,8-dimethyl-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxole (PubChem CID 157276109) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (6S,8R,9R)-9-(1,3-benzodioxol-5-yl)-6,8-dimethyl-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxole.
| Compound Name | (6S,8R,9R)-9-(1,3-benzodioxol-5-yl)-6,8-dimethyl-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxole |
|---|---|
| PubChem CID | 157276109 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (6S,8R,9R)-9-(1,3-benzodioxol-5-yl)-6,8-dimethyl-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxole |
| SMILES | C[C@@H]1C[C@H](C)c2ccc3c(c2[C@H]1c1ccc2c(c1)OCO2)OCO3 |
| InChI | InChI=1S/C20H20O4/c1-11-7-12(2)18(13-3-5-15-17(8-13)23-9-21-15)19-14(11)4-6-16-20(19)24-10-22-16/h3-6,8,11-12,18H,7,9-10H2,1-2H3/t11-,12+,18+/m0/s1 |
| InChIKey | AZCUKURZKHRDTN-VNBZBWLYSA-N |
| XLogP | 4.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |