C43H54N10O2 — CID 157276200
1-[3-(dimethylamino)propyl]-3-[6-(4-methylphenyl)-1H-indazol-3-yl]urea;1-[6-(4-ethylphenyl)-1H-indazol-3-yl]-3-[(1-ethylpyrrolidin-2-yl)methyl]urea (PubChem CID 157276200) has the molecular formula C43H54N10O2 and a molecular weight of 742.97 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-[6-(4-methylphenyl)-1H-indazol-3-yl]urea;1-[6-(4-ethylphenyl)-1H-indazol-3-yl]-3-[(1-ethylpyrrolidin-2-yl)methyl]urea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-[6-(4-methylphenyl)-1H-indazol-3-yl]urea;1-[6-(4-ethylphenyl)-1H-indazol-3-yl]-3-[(1-ethylpyrrolidin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 157276200 |
| Molecular Formula | C43H54N10O2 |
| Molecular Weight | 742.97 g/mol |
| Exact Mass | 742.44 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-[6-(4-methylphenyl)-1H-indazol-3-yl]urea;1-[6-(4-ethylphenyl)-1H-indazol-3-yl]-3-[(1-ethylpyrrolidin-2-yl)methyl]urea |
| SMILES | CCc1ccc(-c2ccc3c(NC(=O)NCC4CCCN4CC)n[nH]c3c2)cc1.Cc1ccc(-c2ccc3c(NC(=O)NCCCN(C)C)n[nH]c3c2)cc1 |
| InChI | InChI=1S/C23H29N5O.C20H25N5O/c1-3-16-7-9-17(10-8-16)18-11-12-20-21(14-18)26-27-22(20)25-23(29)24-15-19-6-5-13-28(19)4-2;1-14-5-7-15(8-6-14)16-9-10-17-18(13-16)23-24-19(17)22-20(26)21-11-4-12-25(2)3/h7-12,14,19H,3-6,13,15H2,1-2H3,(H3,24,25,26,27,29);5-10,13H,4,11-12H2,1-3H3,(H3,21,22,23,24,26) |
| InChIKey | AZDCJRBJOOMZEU-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.97 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|