C43H59N2O6S2+ — CID 157276855
4-[2-[2-[2-tert-butyl-3-[2-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3,5-trimethylindol-1-yl]butane-1-sulfonic acid (PubChem CID 157276855) has the molecular formula C43H59N2O6S2+ and a molecular weight of 764.09 g/mol. Its IUPAC name is 4-[2-[2-[2-tert-butyl-3-[2-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3,5-trimethylindol-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[2-[2-tert-butyl-3-[2-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3,5-trimethylindol-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 157276855 |
| Molecular Formula | C43H59N2O6S2+ |
| Molecular Weight | 764.09 g/mol |
| Exact Mass | 763.38 |
| IUPAC Name | 4-[2-[2-[2-tert-butyl-3-[2-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3,5-trimethylindol-1-yl]butane-1-sulfonic acid |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(=CC=C1CCCC(C=CC3=[N+](CCCCS(=O)(=O)O)c4ccccc4C3(C)C)=C1C(C)(C)C)N2CCCCS(=O)(=O)O |
| InChI | InChI=1S/C43H58N2O6S2/c1-31-20-23-37-35(30-31)43(7,8)39(45(37)27-12-14-29-53(49,50)51)25-22-33-17-15-16-32(40(33)41(2,3)4)21-24-38-42(5,6)34-18-9-10-19-36(34)44(38)26-11-13-28-52(46,47)48/h9-10,18-25,30H,11-17,26-29H2,1-8H3,(H-,46,47,48,49,50,51)/p+1 |
| InChIKey | KBEWPHNHDWIJJR-UHFFFAOYSA-O |
| XLogP | 9.40 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.09 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|