C14H26O2 — CID 157279519
4-hydroxy-1-[(1R,3S)-3-propan-2-ylcyclohexyl]pentan-2-one (PubChem CID 157279519) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 4-hydroxy-1-[(1R,3S)-3-propan-2-ylcyclohexyl]pentan-2-one.
| Compound Name | 4-hydroxy-1-[(1R,3S)-3-propan-2-ylcyclohexyl]pentan-2-one |
|---|---|
| PubChem CID | 157279519 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 4-hydroxy-1-[(1R,3S)-3-propan-2-ylcyclohexyl]pentan-2-one |
| SMILES | CC(O)CC(=O)C[C@@H]1CCC[C@H](C(C)C)C1 |
| InChI | InChI=1S/C14H26O2/c1-10(2)13-6-4-5-12(8-13)9-14(16)7-11(3)15/h10-13,15H,4-9H2,1-3H3/t11?,12-,13+/m1/s1 |
| InChIKey | XBPOHGNGMMNONZ-HDYSRYHKSA-N |
| XLogP | 3.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |