C33H30F6N4O2 — CID 157282155
5-[2-[(2R)-1-(3,5-difluorophenyl)-4-oxo-5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]heptan-2-yl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 157282155) has the molecular formula C33H30F6N4O2 and a molecular weight of 628.62 g/mol. Its IUPAC name is 5-[2-[(2R)-1-(3,5-difluorophenyl)-4-oxo-5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]heptan-2-yl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(2R)-1-(3,5-difluorophenyl)-4-oxo-5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]heptan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 157282155 |
| Molecular Formula | C33H30F6N4O2 |
| Molecular Weight | 628.62 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | 5-[2-[(2R)-1-(3,5-difluorophenyl)-4-oxo-5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]heptan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | CCC(C(=O)C[C@@H](Cc1cc(F)cc(F)c1)c1ncccc1-c1ccc(F)c(C(N)=O)c1)n1nc(C(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C33H30F6N4O2/c1-2-27(43-28-8-4-3-6-24(28)31(42-43)33(37,38)39)29(44)16-20(12-18-13-21(34)17-22(35)14-18)30-23(7-5-11-41-30)19-9-10-26(36)25(15-19)32(40)45/h5,7,9-11,13-15,17,20,27H,2-4,6,8,12,16H2,1H3,(H2,40,45)/t20-,27?/m1/s1 |
| InChIKey | YEPVRHIZZFMNBP-ACVCQEAVSA-N |
| XLogP | 7.30 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.62 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |