C24H40O4S — CID 15728585
methyl (7Z)-7-[2-(3,7-dimethyloctyl)-2-hydroxy-4-methylsulfanyl-5-oxocyclopent-3-en-1-ylidene]heptanoate (PubChem CID 15728585) has the molecular formula C24H40O4S and a molecular weight of 424.65 g/mol. Its IUPAC name is methyl (7Z)-7-[2-(3,7-dimethyloctyl)-2-hydroxy-4-methylsulfanyl-5-oxocyclopent-3-en-1-ylidene]heptanoate.
| Compound Name | methyl (7Z)-7-[2-(3,7-dimethyloctyl)-2-hydroxy-4-methylsulfanyl-5-oxocyclopent-3-en-1-ylidene]heptanoate |
|---|---|
| PubChem CID | 15728585 |
| Molecular Formula | C24H40O4S |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | methyl (7Z)-7-[2-(3,7-dimethyloctyl)-2-hydroxy-4-methylsulfanyl-5-oxocyclopent-3-en-1-ylidene]heptanoate |
| SMILES | COC(=O)CCCCC/C=C1\C(=O)C(SC)=CC1(O)CCC(C)CCCC(C)C |
| InChI | InChI=1S/C24H40O4S/c1-18(2)11-10-12-19(3)15-16-24(27)17-21(29-5)23(26)20(24)13-8-6-7-9-14-22(25)28-4/h13,17-19,27H,6-12,14-16H2,1-5H3/b20-13+ |
| InChIKey | SLAJWABCSXYHMM-DEDYPNTBSA-N |
| XLogP | 5.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|