C22H35ClO4 — CID 54025058
7-[4-chloro-2-(3,7-dimethyloctyl)-2-hydroxy-5-oxocyclopent-3-en-1-ylidene]heptanoic acid (PubChem CID 54025058) has the molecular formula C22H35ClO4 and a molecular weight of 398.97 g/mol. Its IUPAC name is 7-[4-chloro-2-(3,7-dimethyloctyl)-2-hydroxy-5-oxocyclopent-3-en-1-ylidene]heptanoic acid.
| Compound Name | 7-[4-chloro-2-(3,7-dimethyloctyl)-2-hydroxy-5-oxocyclopent-3-en-1-ylidene]heptanoic acid |
|---|---|
| PubChem CID | 54025058 |
| Molecular Formula | C22H35ClO4 |
| Molecular Weight | 398.97 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 7-[4-chloro-2-(3,7-dimethyloctyl)-2-hydroxy-5-oxocyclopent-3-en-1-ylidene]heptanoic acid |
| SMILES | CC(C)CCCC(C)CCC1(O)C=C(Cl)C(=O)C1=CCCCCCC(=O)O |
| InChI | InChI=1S/C22H35ClO4/c1-16(2)9-8-10-17(3)13-14-22(27)15-19(23)21(26)18(22)11-6-4-5-7-12-20(24)25/h11,15-17,27H,4-10,12-14H2,1-3H3,(H,24,25) |
| InChIKey | LBPQVPLRLMNGFA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.97 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|