C23H39ClO4Si — CID 54053765
7-(4-chloro-2-octyl-5-oxo-2-trimethylsilyloxycyclopent-3-en-1-ylidene)heptanoic acid (PubChem CID 54053765) has the molecular formula C23H39ClO4Si and a molecular weight of 443.10 g/mol. Its IUPAC name is 7-(4-chloro-2-octyl-5-oxo-2-trimethylsilyloxycyclopent-3-en-1-ylidene)heptanoic acid.
| Compound Name | 7-(4-chloro-2-octyl-5-oxo-2-trimethylsilyloxycyclopent-3-en-1-ylidene)heptanoic acid |
|---|---|
| PubChem CID | 54053765 |
| Molecular Formula | C23H39ClO4Si |
| Molecular Weight | 443.10 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 7-(4-chloro-2-octyl-5-oxo-2-trimethylsilyloxycyclopent-3-en-1-ylidene)heptanoic acid |
| SMILES | CCCCCCCCC1(O[Si](C)(C)C)C=C(Cl)C(=O)C1=CCCCCCC(=O)O |
| InChI | InChI=1S/C23H39ClO4Si/c1-5-6-7-8-11-14-17-23(28-29(2,3)4)18-20(24)22(27)19(23)15-12-9-10-13-16-21(25)26/h15,18H,5-14,16-17H2,1-4H3,(H,25,26) |
| InChIKey | LUTRNWOXXCFBHW-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.10 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|