C22H33ClO5 — CID 67896094
(7Z)-7-(2-acetyloxy-4-chloro-2-octyl-5-oxocyclopent-3-en-1-ylidene)heptanoic acid (PubChem CID 67896094) has the molecular formula C22H33ClO5 and a molecular weight of 412.95 g/mol. Its IUPAC name is (7Z)-7-(2-acetyloxy-4-chloro-2-octyl-5-oxocyclopent-3-en-1-ylidene)heptanoic acid.
| Compound Name | (7Z)-7-(2-acetyloxy-4-chloro-2-octyl-5-oxocyclopent-3-en-1-ylidene)heptanoic acid |
|---|---|
| PubChem CID | 67896094 |
| Molecular Formula | C22H33ClO5 |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | (7Z)-7-(2-acetyloxy-4-chloro-2-octyl-5-oxocyclopent-3-en-1-ylidene)heptanoic acid |
| SMILES | CCCCCCCCC1(OC(C)=O)C=C(Cl)C(=O)/C1=C\CCCCCC(=O)O |
| InChI | InChI=1S/C22H33ClO5/c1-3-4-5-6-9-12-15-22(28-17(2)24)16-19(23)21(27)18(22)13-10-7-8-11-14-20(25)26/h13,16H,3-12,14-15H2,1-2H3,(H,25,26)/b18-13+ |
| InChIKey | KTTWAKXAPDZOCQ-QGOAFFKASA-N |
| XLogP | 5.71 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|