C24H35ClO8 — CID 70430126
(5S,6R,7E)-5,6-diacetyloxy-7-[(2S)-4-chloro-2-hydroxy-2-octyl-5-oxocyclopent-3-en-1-ylidene]heptanoic acid (PubChem CID 70430126) has the molecular formula C24H35ClO8 and a molecular weight of 486.99 g/mol. Its IUPAC name is (5S,6R,7E)-5,6-diacetyloxy-7-[(2S)-4-chloro-2-hydroxy-2-octyl-5-oxocyclopent-3-en-1-ylidene]heptanoic acid.
| Compound Name | (5S,6R,7E)-5,6-diacetyloxy-7-[(2S)-4-chloro-2-hydroxy-2-octyl-5-oxocyclopent-3-en-1-ylidene]heptanoic acid |
|---|---|
| PubChem CID | 70430126 |
| Molecular Formula | C24H35ClO8 |
| Molecular Weight | 486.99 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (5S,6R,7E)-5,6-diacetyloxy-7-[(2S)-4-chloro-2-hydroxy-2-octyl-5-oxocyclopent-3-en-1-ylidene]heptanoic acid |
| SMILES | CCCCCCCC[C@]1(O)C=C(Cl)C(=O)/C1=C/[C@@H](OC(C)=O)[C@H](CCCC(=O)O)OC(C)=O |
| InChI | InChI=1S/C24H35ClO8/c1-4-5-6-7-8-9-13-24(31)15-19(25)23(30)18(24)14-21(33-17(3)27)20(32-16(2)26)11-10-12-22(28)29/h14-15,20-21,31H,4-13H2,1-3H3,(H,28,29)/b18-14-/t20-,21+,24-/m0/s1 |
| InChIKey | CYFNRPMFJZCGPE-XIPAWQQCSA-N |
| XLogP | 4.22 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.99 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|