C26H35ClO10 — CID 70451444
5,6,7-triacetyloxy-7-[4-chloro-2-hydroxy-2-[(2Z,5Z)-octa-2,5-dienyl]-5-oxocyclopent-3-en-1-yl]heptanoic acid (PubChem CID 70451444) has the molecular formula C26H35ClO10 and a molecular weight of 543.01 g/mol. Its IUPAC name is 5,6,7-triacetyloxy-7-[4-chloro-2-hydroxy-2-[(2Z,5Z)-octa-2,5-dienyl]-5-oxocyclopent-3-en-1-yl]heptanoic acid.
| Compound Name | 5,6,7-triacetyloxy-7-[4-chloro-2-hydroxy-2-[(2Z,5Z)-octa-2,5-dienyl]-5-oxocyclopent-3-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 70451444 |
| Molecular Formula | C26H35ClO10 |
| Molecular Weight | 543.01 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 5,6,7-triacetyloxy-7-[4-chloro-2-hydroxy-2-[(2Z,5Z)-octa-2,5-dienyl]-5-oxocyclopent-3-en-1-yl]heptanoic acid |
| SMILES | CC/C=C\C/C=C\CC1(O)C=C(Cl)C(=O)C1C(OC(C)=O)C(OC(C)=O)C(CCCC(=O)O)OC(C)=O |
| InChI | InChI=1S/C26H35ClO10/c1-5-6-7-8-9-10-14-26(34)15-19(27)23(33)22(26)25(37-18(4)30)24(36-17(3)29)20(35-16(2)28)12-11-13-21(31)32/h6-7,9-10,15,20,22,24-25,34H,5,8,11-14H2,1-4H3,(H,31,32)/b7-6-,10-9- |
| InChIKey | XVWLKGDZSMVZCJ-HZJYTTRNSA-N |
| XLogP | 3.39 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.01 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|