C22H33ClO3 — CID 70402289
(7Z)-7-[3-chloro-5-(3,7-dimethyloct-6-enyl)-2-oxocyclopent-3-en-1-ylidene]heptanoic acid (PubChem CID 70402289) has the molecular formula C22H33ClO3 and a molecular weight of 380.96 g/mol. Its IUPAC name is (7Z)-7-[3-chloro-5-(3,7-dimethyloct-6-enyl)-2-oxocyclopent-3-en-1-ylidene]heptanoic acid.
| Compound Name | (7Z)-7-[3-chloro-5-(3,7-dimethyloct-6-enyl)-2-oxocyclopent-3-en-1-ylidene]heptanoic acid |
|---|---|
| PubChem CID | 70402289 |
| Molecular Formula | C22H33ClO3 |
| Molecular Weight | 380.96 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (7Z)-7-[3-chloro-5-(3,7-dimethyloct-6-enyl)-2-oxocyclopent-3-en-1-ylidene]heptanoic acid |
| SMILES | CC(C)=CCCC(C)CCC1C=C(Cl)C(=O)/C1=C\CCCCCC(=O)O |
| InChI | InChI=1S/C22H33ClO3/c1-16(2)9-8-10-17(3)13-14-18-15-20(23)22(26)19(18)11-6-4-5-7-12-21(24)25/h9,11,15,17-18H,4-8,10,12-14H2,1-3H3,(H,24,25)/b19-11- |
| InChIKey | WINQXIYVJWWLPW-ODLFYWEKSA-N |
| XLogP | 6.43 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.96 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|