C21H23ClO4 — CID 70402738
7-[3-chloro-5-(1-hydroxy-3-phenylprop-1-enyl)-2-oxocyclopent-3-en-1-ylidene]heptanoic acid (PubChem CID 70402738) has the molecular formula C21H23ClO4 and a molecular weight of 374.86 g/mol. Its IUPAC name is 7-[3-chloro-5-(1-hydroxy-3-phenylprop-1-enyl)-2-oxocyclopent-3-en-1-ylidene]heptanoic acid.
| Compound Name | 7-[3-chloro-5-(1-hydroxy-3-phenylprop-1-enyl)-2-oxocyclopent-3-en-1-ylidene]heptanoic acid |
|---|---|
| PubChem CID | 70402738 |
| Molecular Formula | C21H23ClO4 |
| Molecular Weight | 374.86 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 7-[3-chloro-5-(1-hydroxy-3-phenylprop-1-enyl)-2-oxocyclopent-3-en-1-ylidene]heptanoic acid |
| SMILES | O=C(O)CCCCCC=C1C(=O)C(Cl)=CC1C(O)=CCc1ccccc1 |
| InChI | InChI=1S/C21H23ClO4/c22-18-14-17(19(23)13-12-15-8-4-3-5-9-15)16(21(18)26)10-6-1-2-7-11-20(24)25/h3-5,8-10,13-14,17,23H,1-2,6-7,11-12H2,(H,24,25) |
| InChIKey | NLTXQCHJQSWZSG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.86 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|