C27H34N2O5S — CID 139681878
methyl (7E)-7-[2-hydroxy-4-(1-methylimidazol-2-yl)sulfanyl-5-oxo-2-(4-phenoxybutyl)cyclopent-3-en-1-ylidene]heptanoate (PubChem CID 139681878) has the molecular formula C27H34N2O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is methyl (7E)-7-[2-hydroxy-4-(1-methylimidazol-2-yl)sulfanyl-5-oxo-2-(4-phenoxybutyl)cyclopent-3-en-1-ylidene]heptanoate.
| Compound Name | methyl (7E)-7-[2-hydroxy-4-(1-methylimidazol-2-yl)sulfanyl-5-oxo-2-(4-phenoxybutyl)cyclopent-3-en-1-ylidene]heptanoate |
|---|---|
| PubChem CID | 139681878 |
| Molecular Formula | C27H34N2O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | methyl (7E)-7-[2-hydroxy-4-(1-methylimidazol-2-yl)sulfanyl-5-oxo-2-(4-phenoxybutyl)cyclopent-3-en-1-ylidene]heptanoate |
| SMILES | COC(=O)CCCCC/C=C1/C(=O)C(Sc2nccn2C)=CC1(O)CCCCOc1ccccc1 |
| InChI | InChI=1S/C27H34N2O5S/c1-29-18-17-28-26(29)35-23-20-27(32,16-10-11-19-34-21-12-6-5-7-13-21)22(25(23)31)14-8-3-4-9-15-24(30)33-2/h5-7,12-14,17-18,20,32H,3-4,8-11,15-16,19H2,1-2H3/b22-14- |
| InChIKey | LJXXCFUZJDVPGG-HMAPJEAMSA-N |
| XLogP | 5.01 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|