C23H30O5S — CID 15728580
(5Z)-5-[(Z)-4,7-dihydroxyhept-2-enylidene]-4-hydroxy-2-methylsulfanyl-4-(4-phenoxybutyl)cyclopent-2-en-1-one (PubChem CID 15728580) has the molecular formula C23H30O5S and a molecular weight of 418.56 g/mol. Its IUPAC name is (5Z)-5-[(Z)-4,7-dihydroxyhept-2-enylidene]-4-hydroxy-2-methylsulfanyl-4-(4-phenoxybutyl)cyclopent-2-en-1-one.
| Compound Name | (5Z)-5-[(Z)-4,7-dihydroxyhept-2-enylidene]-4-hydroxy-2-methylsulfanyl-4-(4-phenoxybutyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 15728580 |
| Molecular Formula | C23H30O5S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (5Z)-5-[(Z)-4,7-dihydroxyhept-2-enylidene]-4-hydroxy-2-methylsulfanyl-4-(4-phenoxybutyl)cyclopent-2-en-1-one |
| SMILES | CSC1=CC(O)(CCCCOc2ccccc2)/C(=C/C=C\C(O)CCCO)C1=O |
| InChI | InChI=1S/C23H30O5S/c1-29-21-17-23(27,14-5-6-16-28-19-11-3-2-4-12-19)20(22(21)26)13-7-9-18(25)10-8-15-24/h2-4,7,9,11-13,17-18,24-25,27H,5-6,8,10,14-16H2,1H3/b9-7-,20-13+ |
| InChIKey | TTYCPWCOWCUKKS-QFVJZTAWSA-N |
| XLogP | 3.41 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|