C23H32O5S — CID 139681791
(5E)-5-(4,7-dihydroxyheptylidene)-4-hydroxy-2-methylsulfanyl-4-(4-phenoxybutyl)cyclopent-2-en-1-one (PubChem CID 139681791) has the molecular formula C23H32O5S and a molecular weight of 420.57 g/mol. Its IUPAC name is (5E)-5-(4,7-dihydroxyheptylidene)-4-hydroxy-2-methylsulfanyl-4-(4-phenoxybutyl)cyclopent-2-en-1-one.
| Compound Name | (5E)-5-(4,7-dihydroxyheptylidene)-4-hydroxy-2-methylsulfanyl-4-(4-phenoxybutyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 139681791 |
| Molecular Formula | C23H32O5S |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (5E)-5-(4,7-dihydroxyheptylidene)-4-hydroxy-2-methylsulfanyl-4-(4-phenoxybutyl)cyclopent-2-en-1-one |
| SMILES | CSC1=CC(O)(CCCCOc2ccccc2)/C(=C\CCC(O)CCCO)C1=O |
| InChI | InChI=1S/C23H32O5S/c1-29-21-17-23(27,14-5-6-16-28-19-11-3-2-4-12-19)20(22(21)26)13-7-9-18(25)10-8-15-24/h2-4,11-13,17-18,24-25,27H,5-10,14-16H2,1H3/b20-13- |
| InChIKey | WRVSJRGMIFRNGQ-MOSHPQCFSA-N |
| XLogP | 3.64 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|