C27H34O7S — CID 15728595
[(E,7Z)-4-acetyloxy-7-[2-hydroxy-4-methylsulfanyl-5-oxo-2-(4-phenoxybutyl)cyclopent-3-en-1-ylidene]hept-5-enyl] acetate (PubChem CID 15728595) has the molecular formula C27H34O7S and a molecular weight of 502.63 g/mol. Its IUPAC name is [(E,7Z)-4-acetyloxy-7-[2-hydroxy-4-methylsulfanyl-5-oxo-2-(4-phenoxybutyl)cyclopent-3-en-1-ylidene]hept-5-enyl] acetate.
| Compound Name | [(E,7Z)-4-acetyloxy-7-[2-hydroxy-4-methylsulfanyl-5-oxo-2-(4-phenoxybutyl)cyclopent-3-en-1-ylidene]hept-5-enyl] acetate |
|---|---|
| PubChem CID | 15728595 |
| Molecular Formula | C27H34O7S |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | [(E,7Z)-4-acetyloxy-7-[2-hydroxy-4-methylsulfanyl-5-oxo-2-(4-phenoxybutyl)cyclopent-3-en-1-ylidene]hept-5-enyl] acetate |
| SMILES | CSC1=CC(O)(CCCCOc2ccccc2)/C(=C/C=C/C(CCCOC(C)=O)OC(C)=O)C1=O |
| InChI | InChI=1S/C27H34O7S/c1-20(28)32-18-10-14-23(34-21(2)29)13-9-15-24-26(30)25(35-3)19-27(24,31)16-7-8-17-33-22-11-5-4-6-12-22/h4-6,9,11-13,15,19,23,31H,7-8,10,14,16-18H2,1-3H3/b13-9+,24-15+ |
| InChIKey | LBUDFGDFNOSUNM-XZNKGKGBSA-N |
| XLogP | 4.55 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|