C28H38O5S — CID 139681858
(5E)-2-cyclohexylsulfanyl-5-[(E)-4,7-dihydroxyhept-2-enylidene]-4-hydroxy-4-(4-phenoxybutyl)cyclopent-2-en-1-one (PubChem CID 139681858) has the molecular formula C28H38O5S and a molecular weight of 486.67 g/mol. Its IUPAC name is (5E)-2-cyclohexylsulfanyl-5-[(E)-4,7-dihydroxyhept-2-enylidene]-4-hydroxy-4-(4-phenoxybutyl)cyclopent-2-en-1-one.
| Compound Name | (5E)-2-cyclohexylsulfanyl-5-[(E)-4,7-dihydroxyhept-2-enylidene]-4-hydroxy-4-(4-phenoxybutyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 139681858 |
| Molecular Formula | C28H38O5S |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (5E)-2-cyclohexylsulfanyl-5-[(E)-4,7-dihydroxyhept-2-enylidene]-4-hydroxy-4-(4-phenoxybutyl)cyclopent-2-en-1-one |
| SMILES | O=C1C(SC2CCCCC2)=CC(O)(CCCCOc2ccccc2)/C1=C\C=C\C(O)CCCO |
| InChI | InChI=1S/C28H38O5S/c29-19-10-12-22(30)11-9-17-25-27(31)26(34-24-15-5-2-6-16-24)21-28(25,32)18-7-8-20-33-23-13-3-1-4-14-23/h1,3-4,9,11,13-14,17,21-22,24,29-30,32H,2,5-8,10,12,15-16,18-20H2/b11-9+,25-17- |
| InChIKey | AIAVPNSUBPRQTE-DYDDGPENSA-N |
| XLogP | 5.12 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|