C23H28O5S — CID 86746913
5-[(Z)-4,7-dihydroxyhept-2-enylidene]-2-methylsulfinyl-4-(4-phenoxybutylidene)cyclopent-2-en-1-one (PubChem CID 86746913) has the molecular formula C23H28O5S and a molecular weight of 416.54 g/mol. Its IUPAC name is 5-[(Z)-4,7-dihydroxyhept-2-enylidene]-2-methylsulfinyl-4-(4-phenoxybutylidene)cyclopent-2-en-1-one.
| Compound Name | 5-[(Z)-4,7-dihydroxyhept-2-enylidene]-2-methylsulfinyl-4-(4-phenoxybutylidene)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 86746913 |
| Molecular Formula | C23H28O5S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 5-[(Z)-4,7-dihydroxyhept-2-enylidene]-2-methylsulfinyl-4-(4-phenoxybutylidene)cyclopent-2-en-1-one |
| SMILES | CS(=O)C1=CC(=CCCCOc2ccccc2)C(=C/C=C\C(O)CCCO)C1=O |
| InChI | InChI=1S/C23H28O5S/c1-29(27)22-17-18(9-5-6-16-28-20-12-3-2-4-13-20)21(23(22)26)14-7-10-19(25)11-8-15-24/h2-4,7,9-10,12-14,17,19,24-25H,5-6,8,11,15-16H2,1H3/b10-7-,18-9?,21-14? |
| InChIKey | HEFBWWUZTNTXJW-FLEMGNLESA-N |
| XLogP | 3.23 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|