About 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone
2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone (PubChem CID 157286862) has the molecular formula C13H11N7O2
and a molecular weight of 297.28 g/mol. Its IUPAC name is 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone.
Molecular Properties
| Compound Name | 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone |
| PubChem CID | 157286862 |
| Molecular Formula | C13H11N7O2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone |
| SMILES | O=C(n1ccnc1)n1ccnc1.Oc1cccc2n[nH]nc12 |
| InChI | InChI=1S/C7H6N4O.C6H5N3O/c12-7(10-3-1-8-5-10)11-4-2-9-6-11;10-5-3-1-2-4-6(5)8-9-7-4/h1-6H;1-3,10H,(H,7,8,9) |
| InChIKey | BAIIRPYICDXMEZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone?
The IUPAC name of 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone (CID 157286862) is 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone.
What is the SMILES notation for 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone?
The canonical SMILES for 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone is O=C(n1ccnc1)n1ccnc1.Oc1cccc2n[nH]nc12.
What is the InChIKey of 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone?
The InChIKey is BAIIRPYICDXMEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O.C6H5N3O/c12-7(10-3-1-8-5-10)11-4-2-9-6-11;10-5-3-1-2-4-6(5)8-9-7-4/h1-6H;1-3,10H,(H,7,8,9).
What are the key properties of 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone?
2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone has a molecular weight of 297.28 g/mol, XLogP of 1.26, 0 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazol-4-ol;di(imidazol-1-yl)methanone is sourced from PubChem (CID 157286862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).