About di(imidazol-1-yl)methanone;1,2-oxazole
di(imidazol-1-yl)methanone;1,2-oxazole (PubChem CID 172682616) has the molecular formula C10H9N5O2
and a molecular weight of 231.22 g/mol. Its IUPAC name is di(imidazol-1-yl)methanone;1,2-oxazole.
Molecular Properties
| Compound Name | di(imidazol-1-yl)methanone;1,2-oxazole |
| PubChem CID | 172682616 |
| Molecular Formula | C10H9N5O2 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | di(imidazol-1-yl)methanone;1,2-oxazole |
| SMILES | O=C(n1ccnc1)n1ccnc1.c1cnoc1 |
| InChI | InChI=1S/C7H6N4O.C3H3NO/c12-7(10-3-1-8-5-10)11-4-2-9-6-11;1-2-4-5-3-1/h1-6H;1-3H |
| InChIKey | APMWRUFZRCDLLJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze di(imidazol-1-yl)methanone;1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(imidazol-1-yl)methanone;1,2-oxazole?
The IUPAC name of di(imidazol-1-yl)methanone;1,2-oxazole (CID 172682616) is di(imidazol-1-yl)methanone;1,2-oxazole.
What is the SMILES notation for di(imidazol-1-yl)methanone;1,2-oxazole?
The canonical SMILES for di(imidazol-1-yl)methanone;1,2-oxazole is O=C(n1ccnc1)n1ccnc1.c1cnoc1.
What is the InChIKey of di(imidazol-1-yl)methanone;1,2-oxazole?
The InChIKey is APMWRUFZRCDLLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O.C3H3NO/c12-7(10-3-1-8-5-10)11-4-2-9-6-11;1-2-4-5-3-1/h1-6H;1-3H.
What are the key properties of di(imidazol-1-yl)methanone;1,2-oxazole?
di(imidazol-1-yl)methanone;1,2-oxazole has a molecular weight of 231.22 g/mol, XLogP of 1.27, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for di(imidazol-1-yl)methanone;1,2-oxazole is sourced from PubChem (CID 172682616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).