C30H33N3O — CID 157289205
[4-cyclobutyl-5-(5-ethyl-1H-pyrazol-3-yl)-2-methylphenyl]-[4-(4-ethynylphenyl)piperidin-1-yl]methanone (PubChem CID 157289205) has the molecular formula C30H33N3O and a molecular weight of 451.61 g/mol. Its IUPAC name is [4-cyclobutyl-5-(5-ethyl-1H-pyrazol-3-yl)-2-methylphenyl]-[4-(4-ethynylphenyl)piperidin-1-yl]methanone.
| Compound Name | [4-cyclobutyl-5-(5-ethyl-1H-pyrazol-3-yl)-2-methylphenyl]-[4-(4-ethynylphenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 157289205 |
| Molecular Formula | C30H33N3O |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | [4-cyclobutyl-5-(5-ethyl-1H-pyrazol-3-yl)-2-methylphenyl]-[4-(4-ethynylphenyl)piperidin-1-yl]methanone |
| SMILES | C#Cc1ccc(C2CCN(C(=O)c3cc(-c4cc(CC)[nH]n4)c(C4CCC4)cc3C)CC2)cc1 |
| InChI | InChI=1S/C30H33N3O/c1-4-21-9-11-22(12-10-21)23-13-15-33(16-14-23)30(34)26-19-28(29-18-25(5-2)31-32-29)27(17-20(26)3)24-7-6-8-24/h1,9-12,17-19,23-24H,5-8,13-16H2,2-3H3,(H,31,32) |
| InChIKey | BAPFYMJKJKTUGF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|