C25H29N — CID 130216708
1-[1-(4,5-diethyl-2-methylphenyl)ethenyl]-3-(4-ethynylphenyl)pyrrolidine (PubChem CID 130216708) has the molecular formula C25H29N and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-[1-(4,5-diethyl-2-methylphenyl)ethenyl]-3-(4-ethynylphenyl)pyrrolidine.
| Compound Name | 1-[1-(4,5-diethyl-2-methylphenyl)ethenyl]-3-(4-ethynylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 130216708 |
| Molecular Formula | C25H29N |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-[1-(4,5-diethyl-2-methylphenyl)ethenyl]-3-(4-ethynylphenyl)pyrrolidine |
| SMILES | C#Cc1ccc(C2CCN(C(=C)c3cc(CC)c(CC)cc3C)C2)cc1 |
| InChI | InChI=1S/C25H29N/c1-6-20-9-11-23(12-10-20)24-13-14-26(17-24)19(5)25-16-22(8-3)21(7-2)15-18(25)4/h1,9-12,15-16,24H,5,7-8,13-14,17H2,2-4H3 |
| InChIKey | FVBRLWIFZNBCFS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|