C15H16N5+ — CID 157292294
2-(1,3-dimethylimidazol-1-ium-2-yl)-3-methylimidazo[1,2-a]benzimidazole (PubChem CID 157292294) has the molecular formula C15H16N5+ and a molecular weight of 266.33 g/mol. Its IUPAC name is 2-(1,3-dimethylimidazol-1-ium-2-yl)-3-methylimidazo[1,2-a]benzimidazole.
| Compound Name | 2-(1,3-dimethylimidazol-1-ium-2-yl)-3-methylimidazo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 157292294 |
| Molecular Formula | C15H16N5+ |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(1,3-dimethylimidazol-1-ium-2-yl)-3-methylimidazo[1,2-a]benzimidazole |
| SMILES | Cn1cc[n+](C)c1-c1cn2c3ccccc3nc2n1C |
| InChI | InChI=1S/C15H16N5/c1-17-8-9-18(2)14(17)13-10-20-12-7-5-4-6-11(12)16-15(20)19(13)3/h4-10H,1-3H3/q+1 |
| InChIKey | PDNAUTVGYQWKGE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 31.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|