C23H21N4+ — CID 140944490
3-methyl-2-[1-methyl-4-phenyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]imidazo[1,2-a]benzimidazole (PubChem CID 140944490) has the molecular formula C23H21N4+ and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-methyl-2-[1-methyl-4-phenyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]imidazo[1,2-a]benzimidazole.
| Compound Name | 3-methyl-2-[1-methyl-4-phenyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]imidazo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 140944490 |
| Molecular Formula | C23H21N4+ |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 3-methyl-2-[1-methyl-4-phenyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]imidazo[1,2-a]benzimidazole |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2cn3c4ccccc4nc3n2C)cc1-c1ccccc1 |
| InChI | InChI=1S/C23H21N4/c1-16-14-25(2)21(13-18(16)17-9-5-4-6-10-17)22-15-27-20-12-8-7-11-19(20)24-23(27)26(22)3/h4-15H,1-3H3/q+1/i1D3 |
| InChIKey | QQBOVGHIDBUGSC-FIBGUPNXSA-N |
| XLogP | 4.29 |
| TPSA | 26.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|