C24H27F3N2OS — CID 157294389
2-[[4-octoxy-3-(trifluoromethyl)phenyl]methyl]-5-pyridin-3-yl-1,3-thiazole (PubChem CID 157294389) has the molecular formula C24H27F3N2OS and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-[[4-octoxy-3-(trifluoromethyl)phenyl]methyl]-5-pyridin-3-yl-1,3-thiazole.
| Compound Name | 2-[[4-octoxy-3-(trifluoromethyl)phenyl]methyl]-5-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 157294389 |
| Molecular Formula | C24H27F3N2OS |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-[[4-octoxy-3-(trifluoromethyl)phenyl]methyl]-5-pyridin-3-yl-1,3-thiazole |
| SMILES | CCCCCCCCOc1ccc(Cc2ncc(-c3cccnc3)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H27F3N2OS/c1-2-3-4-5-6-7-13-30-21-11-10-18(14-20(21)24(25,26)27)15-23-29-17-22(31-23)19-9-8-12-28-16-19/h8-12,14,16-17H,2-7,13,15H2,1H3 |
| InChIKey | BBEDPSZNEQBWCS-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|