C63H61N5O12 — CID 157294515
4-O-(2-aminophenyl) 1-O-(4-aminophenyl) benzene-1,4-dicarboxylate;3-O-(2-aminophenyl) 1-O-(4-methylphenyl) benzene-1,3-dicarboxylate;bis(4-aminophenyl) decanedioate (PubChem CID 157294515) has the molecular formula C63H61N5O12 and a molecular weight of 1080.20 g/mol. Its IUPAC name is 4-O-(2-aminophenyl) 1-O-(4-aminophenyl) benzene-1,4-dicarboxylate;3-O-(2-aminophenyl) 1-O-(4-methylphenyl) benzene-1,3-dicarboxylate;bis(4-aminophenyl) decanedioate.
| Compound Name | 4-O-(2-aminophenyl) 1-O-(4-aminophenyl) benzene-1,4-dicarboxylate;3-O-(2-aminophenyl) 1-O-(4-methylphenyl) benzene-1,3-dicarboxylate;bis(4-aminophenyl) decanedioate |
|---|---|
| PubChem CID | 157294515 |
| Molecular Formula | C63H61N5O12 |
| Molecular Weight | 1080.20 g/mol |
| Exact Mass | 1079.43 |
| IUPAC Name | 4-O-(2-aminophenyl) 1-O-(4-aminophenyl) benzene-1,4-dicarboxylate;3-O-(2-aminophenyl) 1-O-(4-methylphenyl) benzene-1,3-dicarboxylate;bis(4-aminophenyl) decanedioate |
| SMILES | Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccccc3N)c2)cc1.Nc1ccc(OC(=O)CCCCCCCCC(=O)Oc2ccc(N)cc2)cc1.Nc1ccc(OC(=O)c2ccc(C(=O)Oc3ccccc3N)cc2)cc1 |
| InChI | InChI=1S/C22H28N2O4.C21H17NO4.C20H16N2O4/c23-17-9-13-19(14-10-17)27-21(25)7-5-3-1-2-4-6-8-22(26)28-20-15-11-18(24)12-16-20;1-14-9-11-17(12-10-14)25-20(23)15-5-4-6-16(13-15)21(24)26-19-8-3-2-7-18(19)22;21-15-9-11-16(12-10-15)25-19(23)13-5-7-14(8-6-13)20(24)26-18-4-2-1-3-17(18)22/h9-16H,1-8,23-24H2;2-13H,22H2,1H3;1-12H,21-22H2 |
| InChIKey | BBEPGXADXLJDGL-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 287.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1080.20 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|