C22H23B3F2O7S — CID 157296001
CID 157296001 (PubChem CID 157296001) has the molecular formula C22H23B3F2O7S and a molecular weight of 501.92 g/mol.
| Compound Name | CID 157296001 |
|---|---|
| PubChem CID | 157296001 |
| Molecular Formula | C22H23B3F2O7S |
| Molecular Weight | 501.92 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(C[B])c(C[B])c(C(=O)OC23CC4CC(C2)CC(OC(=O)C(F)(F)S(=O)(=O)O)(C4)C3)c1 |
| InChI | InChI=1S/C22H23B3F2O7S/c23-8-12-2-15(9-24)17(10-25)16(3-12)18(28)33-20-4-13-1-14(5-20)7-21(6-13,11-20)34-19(29)22(26,27)35(30,31)32/h2-3,13-14H,1,4-11H2,(H,30,31,32) |
| InChIKey | QCTHKEMFNBSTPR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.92 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|