C26H32N2O3S — CID 157300024
5-methyl-2,3-dihydro-1H-indole;[methyl-[2-(3-methylphenyl)ethyl]amino] 4-methylbenzenesulfonate (PubChem CID 157300024) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is 5-methyl-2,3-dihydro-1H-indole;[methyl-[2-(3-methylphenyl)ethyl]amino] 4-methylbenzenesulfonate.
| Compound Name | 5-methyl-2,3-dihydro-1H-indole;[methyl-[2-(3-methylphenyl)ethyl]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 157300024 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 5-methyl-2,3-dihydro-1H-indole;[methyl-[2-(3-methylphenyl)ethyl]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON(C)CCc2cccc(C)c2)cc1.Cc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C17H21NO3S.C9H11N/c1-14-7-9-17(10-8-14)22(19,20)21-18(3)12-11-16-6-4-5-15(2)13-16;1-7-2-3-9-8(6-7)4-5-10-9/h4-10,13H,11-12H2,1-3H3;2-3,6,10H,4-5H2,1H3 |
| InChIKey | BBUCWDSTTOMHAN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|